4,4'-Dichloro-(1,1'-biphenyl)-3,3'-diol structure
|
Common Name | 4,4'-Dichloro-(1,1'-biphenyl)-3,3'-diol | ||
|---|---|---|---|---|
| CAS Number | 53905-37-6 | Molecular Weight | 255.09700 | |
| Density | 1.453g/cm3 | Boiling Point | 416.1ºC at 760 mmHg | |
| Molecular Formula | C12H8Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.4ºC | |
| Name | 2-chloro-5-(4-chloro-3-hydroxyphenyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 416.1ºC at 760 mmHg |
| Molecular Formula | C12H8Cl2O2 |
| Molecular Weight | 255.09700 |
| Flash Point | 205.4ºC |
| Exact Mass | 253.99000 |
| PSA | 40.46000 |
| LogP | 4.07160 |
| Index of Refraction | 1.655 |
| InChIKey | HCMZQOFFKKISQI-UHFFFAOYSA-N |
| SMILES | Oc1cc(-c2ccc(Cl)c(O)c2)ccc1Cl |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 4,4'-Dichloro[1,1'-biphenyl]-3,3'-diol |
| 4,4'-Dichloro-3,3'-biphenyldiol |
| [1,1'-Biphenyl]-3,3'-diol,4,4'-dichloro |