2-acetyloxybenzoic acid,1,3,7-trimethylpurine-2,6-dione structure
|
Common Name | 2-acetyloxybenzoic acid,1,3,7-trimethylpurine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 53908-20-6 | Molecular Weight | 374.34800 | |
| Density | N/A | Boiling Point | 416.8ºC at 760mmHg | |
| Molecular Formula | C17H18N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.9ºC | |
| Name | 2-acetyloxybenzoic acid,1,3,7-trimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 416.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.34800 |
| Flash Point | 205.9ºC |
| Exact Mass | 374.12300 |
| PSA | 125.42000 |
| LogP | 0.28080 |
| InChIKey | AEDBPCUEFFFHBP-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccccc1C(=O)O.Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| Caffeine mixture with aspirin |
| Benzoic acid,2-(acetyloxy)-,mixt. with 3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione |
| 2-(Acetyloxy)benzoic acid mixt. with 3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione |