Propanamide,2-hydroxy-N,N-dioctyl- structure
|
Common Name | Propanamide,2-hydroxy-N,N-dioctyl- | ||
|---|---|---|---|---|
| CAS Number | 5392-36-9 | Molecular Weight | 313.51800 | |
| Density | 0.91g/cm3 | Boiling Point | 423.8ºC at 760 mmHg | |
| Molecular Formula | C19H39NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.1ºC | |
| Name | N,N-dioctyl-DL-lactamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.91g/cm3 |
|---|---|
| Boiling Point | 423.8ºC at 760 mmHg |
| Molecular Formula | C19H39NO2 |
| Molecular Weight | 313.51800 |
| Flash Point | 210.1ºC |
| Exact Mass | 313.29800 |
| PSA | 40.54000 |
| LogP | 4.91680 |
| Index of Refraction | 1.465 |
| InChIKey | QOOLVMWGEUYJLP-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)C(C)O |
|
~%
Propanamide,2-h... CAS#:5392-36-9 |
| Literature: Fein; Filachione Journal of the American Chemical Society, 1953 , vol. 75, p. 2097 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-cyclohexyl-lactamide |
| Dl-Milchsaeure-dioctylamid |
| Propanamide,N-cyclohexyl-2-hydroxy |
| DL-Milchsaeure-cyclohexylamid |