(2-[4-AMINOSULPHONYL-PHENYL]-ETHYL)-5-METHYLPYRAZINECARBOXAMIDE structure
|
Common Name | (2-[4-AMINOSULPHONYL-PHENYL]-ETHYL)-5-METHYLPYRAZINECARBOXAMIDE | ||
|---|---|---|---|---|
| CAS Number | 53921-74-7 | Molecular Weight | 233.26300 | |
| Density | 1.222g/cm3 | Boiling Point | 476.5ºC at 760mmHg | |
| Molecular Formula | C13H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242ºC | |
| Name | 2-(2-acetyl-3,4-dihydro-1H-isoquinolin-1-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 476.5ºC at 760mmHg |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.26300 |
| Flash Point | 242ºC |
| Exact Mass | 233.10500 |
| PSA | 57.61000 |
| LogP | 1.54490 |
| Index of Refraction | 1.564 |
| InChIKey | QZBDYCNMWXWQNV-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCc2ccccc2C1CC(=O)O |
| HS Code | 2933499090 |
|---|
|
~90%
(2-[4-AMINOSULP... CAS#:53921-74-7 |
| Literature: Yamanaka, Hiroshi; Shiraishi, Takayuki; Sakamoto, Takao; Matsuda, Hitomi Chemical & Pharmaceutical Bulletin, 1981 , vol. 29, # 4 p. 1049 - 1055 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2-acetyl-1,2,3,4-tetrahydro-isoquinolin-1-yl)-acetic acid |
| 2-Acetyl-1,2,3,4-tetrahydroisochinolinessigsaeure |
| 2-acetyl-1,2,3,4-tetrahydroisoquinoline-1-acetic acid |
| N-Acetyl-1,2,3,4-tetrahydroisochinolin-1-essigsaeure |