Benzenamine,N,N'-(1,2-dimethyl-1,2- ethanediylidene)bis- structure
|
Common Name | Benzenamine,N,N'-(1,2-dimethyl-1,2- ethanediylidene)bis- | ||
|---|---|---|---|---|
| CAS Number | 5393-49-7 | Molecular Weight | 236.31200 | |
| Density | 0.98g/cm3 | Boiling Point | 364.1ºC at 760 mmHg | |
| Molecular Formula | C16H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.3ºC | |
| Name | 2-N,3-N-diphenylbutane-2,3-diimine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.98g/cm3 |
|---|---|
| Boiling Point | 364.1ºC at 760 mmHg |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.31200 |
| Flash Point | 166.3ºC |
| Exact Mass | 236.13100 |
| PSA | 24.72000 |
| LogP | 4.57160 |
| Index of Refraction | 1.551 |
| InChIKey | KLYTUKWIWXAUFO-UHFFFAOYSA-N |
| SMILES | CC(=Nc1ccccc1)C(C)=Nc1ccccc1 |
|
~84%
Benzenamine,N,N... CAS#:5393-49-7 |
| Literature: Chung, Cheol K.; Grubbs, Robert H. Organic Letters, 2008 , vol. 10, # 13 p. 2693 - 2696 |
|
~%
Benzenamine,N,N... CAS#:5393-49-7 |
| Literature: Rose; Weedon Journal of the Chemical Society, 1949 , p. 782,785 |
|
~%
Benzenamine,N,N... CAS#:5393-49-7 |
| Literature: Rose; Weedon Journal of the Chemical Society, 1949 , p. 784 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| KLYTUKWIWXAUFO-UHFFFAOYSA |
| 1,4-Diphenyl-2,3-dimethyl-1,4-diaza-1,3-butadien |
| 2,3-Dimethyl-1,4-diphenyl-1,4-diazabuta-1,3-dien |
| 1,4-diphenyl-2,3-dimethyl-1,4-diaza-1,3-butadiene |
| N,N'-bis-(phenyl)-1,2-dimethyl-ethane-1,2-diimine |
| 1,4-diaza-1,4-diphenyl-2,3-dimethyl-1,3-butadiene |
| 1,4-diaza-2,3-dimethyl-1,4-diphenyl-1,3-butadiene |