Carbamic acid,cinnamylidenedi-, diethyl ester (8CI) structure
|
Common Name | Carbamic acid,cinnamylidenedi-, diethyl ester (8CI) | ||
|---|---|---|---|---|
| CAS Number | 5394-38-7 | Molecular Weight | 292.33000 | |
| Density | 1.148g/cm3 | Boiling Point | 489.5ºC at 760mmHg | |
| Molecular Formula | C15H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.9ºC | |
| Name | Zimtaldehyd-dicarbamat |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 489.5ºC at 760mmHg |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33000 |
| Flash Point | 249.9ºC |
| Exact Mass | 292.14200 |
| PSA | 76.66000 |
| LogP | 3.29990 |
| Index of Refraction | 1.546 |
| InChIKey | YSQIMDKZWPRMBZ-ZHACJKMWSA-N |
| SMILES | CCOC(=O)NC(C=Cc1ccccc1)NC(=O)OCC |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Zimtaldehyd-acetylhydrazon |