N-(3-acetylphenyl)-N,4-dimethyl-benzenesulfonamide
Modify Date: 2025-08-26 06:58:05
N-(3-acetylphenyl)-N,4-dimethyl-benzenesulfonamide structure
|
Common Name | N-(3-acetylphenyl)-N,4-dimethyl-benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 5394-49-0 | Molecular Weight | 303.37600 | |
| Density | 1.238g/cm3 | Boiling Point | 472.5ºC at 760 mmHg | |
| Molecular Formula | C16H17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.6ºC | |
| Name | 3'-acetyl-n-methyl-p-toluenesulfonanilide |
|---|
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 472.5ºC at 760 mmHg |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.37600 |
| Flash Point | 239.6ºC |
| Exact Mass | 303.09300 |
| PSA | 62.83000 |
| LogP | 4.10350 |
| Index of Refraction | 1.591 |
| InChIKey | NGQLIMCNYHEETR-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc(N(C)S(=O)(=O)c2ccc(C)cc2)c1 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1