1H-Cyclohepta(1,2-d:4,5-d')diimidazole-2,6-diamine, N6,N6,4-trimethyl structure
|
Common Name | 1H-Cyclohepta(1,2-d:4,5-d')diimidazole-2,6-diamine, N6,N6,4-trimethyl | ||
|---|---|---|---|---|
| CAS Number | 53941-25-6 | Molecular Weight | 242.28000 | |
| Density | 1.47g/cm3 | Boiling Point | 496ºC at 760 mmHg | |
| Molecular Formula | C12H14N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.8ºC | |
| Name | 1H-Cyclohepta(1,2-d:4,5-d')diimidazole-2,6-diamine, N6,N6,4-trimethyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 496ºC at 760 mmHg |
| Molecular Formula | C12H14N6 |
| Molecular Weight | 242.28000 |
| Flash Point | 253.8ºC |
| Exact Mass | 242.12800 |
| PSA | 84.45000 |
| LogP | 1.39280 |
| Index of Refraction | 1.763 |
| InChIKey | NSYIAXVMZBXXKF-UHFFFAOYSA-N |
| SMILES | Cc1c2nc(N(C)C)nc-2ccc2[nH]c(N)nc12 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Cyclohepta(1,2-d:4,5-d')diimidazole-2,6-diamine,N6,N6,4-trimethyl |