benzyl N-(3,4-dimethyl-2,5-dioxo-1,4-diazabicyclo[4.3.0]non-3-yl)carbamate structure
|
Common Name | benzyl N-(3,4-dimethyl-2,5-dioxo-1,4-diazabicyclo[4.3.0]non-3-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 53941-83-6 | Molecular Weight | 331.36600 | |
| Density | 1.31g/cm3 | Boiling Point | 577.9ºC at 760 mmHg | |
| Molecular Formula | C17H21N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.3ºC | |
| Name | benzyl N-(2,3-dimethyl-1,4-dioxo-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazin-3-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 577.9ºC at 760 mmHg |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.36600 |
| Flash Point | 303.3ºC |
| Exact Mass | 331.15300 |
| PSA | 78.95000 |
| LogP | 1.35870 |
| Index of Refraction | 1.609 |
| InChIKey | JVFZVOWNXZDZJP-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2CCCN2C(=O)C1(C)NC(=O)OCc1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| BENZYL N-(3,4-DIMETHYL-2,5-DIOXO-1,4-DIAZABICYCLO[4.3.0]NON-3-YL)CARBAMATE |
| Benzyl 2,3-dimethyl-1,4-dioxooctahydropyrrolo[1,2-a]pyrazin-3-ylcarbamate |
| (2,3-dimethyl-1,4-dioxo-octahydro-pyrrolo[1,2-a]pyrazin-3-yl)-carbamic acid benzyl ester |