hexyl 2-[2-[2-(1-hexoxycarbonylethoxycarbonyloxy)ethoxy]ethoxycarbonyloxy]propanoate
Modify Date: 2025-09-19 17:59:01
![hexyl 2-[2-[2-(1-hexoxycarbonylethoxycarbonyloxy)ethoxy]ethoxycarbonyloxy]propanoate Structure](https://image.chemsrc.com/caspic/271/5396-39-4.png)
hexyl 2-[2-[2-(1-hexoxycarbonylethoxycarbonyloxy)ethoxy]ethoxycarbonyloxy]propanoate structure
|
Common Name | hexyl 2-[2-[2-(1-hexoxycarbonylethoxycarbonyloxy)ethoxy]ethoxycarbonyloxy]propanoate | ||
|---|---|---|---|---|
| CAS Number | 5396-39-4 | Molecular Weight | 506.58400 | |
| Density | 1.104g/cm3 | Boiling Point | 549.3ºC at 760 mmHg | |
| Molecular Formula | C24H42O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.5ºC | |
| Name | bis(2-hydroxyethyl)ether, dicarbonate, diester with hexyl lactate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.104g/cm3 |
|---|---|
| Boiling Point | 549.3ºC at 760 mmHg |
| Molecular Formula | C24H42O11 |
| Molecular Weight | 506.58400 |
| Flash Point | 229.5ºC |
| Exact Mass | 506.27300 |
| PSA | 132.89000 |
| LogP | 4.33340 |
| Index of Refraction | 1.459 |
| InChIKey | RPRXIXAARYZRCC-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)C(C)OC(=O)OCCOCCOC(=O)OC(C)C(=O)OCCCCCC |
| HS Code | 2918990090 |
|---|
|
~%
hexyl 2-[2-[2-(... CAS#:5396-39-4 |
| Literature: Rehberg; Dixon; Fisher Journal of Organic Chemistry, 1949 , vol. 14, p. 594,600 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Diethylamino-8-hydroxy-3,6-dioxa-octan |