methyl 2,3-dibromo-3-(4-hydroxy-3-methoxy-phenyl)propanoate structure
|
Common Name | methyl 2,3-dibromo-3-(4-hydroxy-3-methoxy-phenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 5396-66-7 | Molecular Weight | 368.01900 | |
| Density | 1.763g/cm3 | Boiling Point | 384.2ºC at 760 mmHg | |
| Molecular Formula | C11H12Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.2ºC | |
| Name | methyl 2,3-dibromo-3-(4-hydroxy-3-methoxyphenyl)propanoate |
|---|
| Density | 1.763g/cm3 |
|---|---|
| Boiling Point | 384.2ºC at 760 mmHg |
| Molecular Formula | C11H12Br2O4 |
| Molecular Weight | 368.01900 |
| Flash Point | 186.2ºC |
| Exact Mass | 365.91000 |
| PSA | 55.76000 |
| LogP | 2.77330 |
| Index of Refraction | 1.594 |
| InChIKey | XORGKABKTNFJJJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Br)C(Br)c1ccc(O)c(OC)c1 |
| HS Code | 2918990090 |
|---|
|
~%
methyl 2,3-dibr... CAS#:5396-66-7 |
| Literature: Adler; Bjoerkqvist Acta Chemica Scandinavica (1947-1973), 1953 , vol. 7, p. 561,568 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |