Furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)- one,5-(3,4-dimethoxyphenyl)-9-hydroxy- structure
|
Common Name | Furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)- one,5-(3,4-dimethoxyphenyl)-9-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 53965-06-3 | Molecular Weight | 380.34800 | |
| Density | 1.445g/cm3 | Boiling Point | 631.6ºC at 760 mmHg | |
| Molecular Formula | C21H16O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.7ºC | |
| Name | 9-(3,4-dimethoxyphenyl)-5-hydroxy-6H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.445g/cm3 |
|---|---|
| Boiling Point | 631.6ºC at 760 mmHg |
| Molecular Formula | C21H16O7 |
| Molecular Weight | 380.34800 |
| Flash Point | 229.7ºC |
| Exact Mass | 380.09000 |
| PSA | 83.45000 |
| LogP | 3.62870 |
| Index of Refraction | 1.679 |
| InChIKey | ZYUVOQCJYNAWNV-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2c3c(c(O)c4cc5c(cc24)OCO5)COC3=O)cc1OC |
|
~87%
Furo[3',4':6,7]... CAS#:53965-06-3 |
| Literature: Iwasaki; Kondo; Nishitani; Kuroda; Hirakoso; Ohtani; Takashima Chemical and Pharmaceutical Bulletin, 1995 , vol. 43, # 10 p. 1701 - 1705 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Isodiphyllin |
| chinensinaphthol |
| LIGNAN DERIV |
| 6'-hydroxyjusticidin B |