tert-butyl 3-hydroxy-3-phenyl-propanoate structure
|
Common Name | tert-butyl 3-hydroxy-3-phenyl-propanoate | ||
|---|---|---|---|---|
| CAS Number | 5397-27-3 | Molecular Weight | 222.28000 | |
| Density | 1.076g/cm3 | Boiling Point | 332.1ºC at 760 mmHg | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.7ºC | |
| Name | tert-butyl 3-hydroxy-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.076g/cm3 |
|---|---|
| Boiling Point | 332.1ºC at 760 mmHg |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28000 |
| Flash Point | 134.7ºC |
| Exact Mass | 222.12600 |
| PSA | 46.53000 |
| LogP | 2.45180 |
| Index of Refraction | 1.514 |
| InChIKey | VROUOYSBYGPRJC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(O)c1ccccc1 |
| HS Code | 2918199090 |
|---|
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-hydroxy-3-phenyl-propionic acid tert-butyl ester |
| tert-butyl 3-hydroxy-3-phenylpropionate |
| tert-butyl 3-phenyl-3-hydroxypropanoate |
| 3-hydroxy-3-phenylpropionic acid t-butyl ester |
| 3-Hydroxy-3-phenyl-propionsaeure-tert-butylester |