12-nitrodinaphtho[2,1-b:2',3'-d]furan-8,13-dione structure
|
Common Name | 12-nitrodinaphtho[2,1-b:2',3'-d]furan-8,13-dione | ||
|---|---|---|---|---|
| CAS Number | 5397-98-8 | Molecular Weight | 343.28900 | |
| Density | 1.546g/cm3 | Boiling Point | 608.4ºC at 760 mmHg | |
| Molecular Formula | C20H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321.8ºC | |
| Name | 12-nitrodinaphtho[2,1-b:2',3'-d]furan-8,13-dione |
|---|
| Density | 1.546g/cm3 |
|---|---|
| Boiling Point | 608.4ºC at 760 mmHg |
| Molecular Formula | C20H9NO5 |
| Molecular Weight | 343.28900 |
| Flash Point | 321.8ºC |
| Exact Mass | 343.04800 |
| PSA | 93.10000 |
| LogP | 4.79280 |
| Index of Refraction | 1.78 |
| InChIKey | FXNILQHAHPWMPS-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)c2c1oc1ccc3ccccc3c21 |
|
~%
12-nitrodinapht... CAS#:5397-98-8 |
| Literature: Sartori Journal of Organic Chemistry, 1959 , vol. 24, p. 1756,1758 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |