2-[(4-methylphenyl)methyl]benzoic acid structure
|
Common Name | 2-[(4-methylphenyl)methyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 5398-16-3 | Molecular Weight | 226.27000 | |
| Density | 1.144g/cm3 | Boiling Point | 377.7ºC at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176ºC | |
| Name | 2-[(4-methylphenyl)methyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 377.7ºC at 760 mmHg |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Flash Point | 176ºC |
| Exact Mass | 226.09900 |
| PSA | 37.30000 |
| LogP | 3.28400 |
| Index of Refraction | 1.596 |
| InChIKey | FVHMOFPRPCTXCM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cc2ccccc2C(=O)O)cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-p-Tolubenzyl-benzoesaeure |
| 2-p-Xylyl-benzoesaeure |