3-hydroxy-4,4,14-trimethyl-7,11-dioxocholan-24-oic acid structure
|
Common Name | 3-hydroxy-4,4,14-trimethyl-7,11-dioxocholan-24-oic acid | ||
|---|---|---|---|---|
| CAS Number | 5399-41-7 | Molecular Weight | 446.61900 | |
| Density | 1.124g/cm3 | Boiling Point | 584.9ºC at 760 mmHg | |
| Molecular Formula | C27H42O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321.6ºC | |
| Name | 3.β.-HYDROXY-7,11-DIOXO-4,4,14-TRIMETHYL-5.α.-CHOLAN-24-OIC ACID |
|---|
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 584.9ºC at 760 mmHg |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.61900 |
| Flash Point | 321.6ºC |
| Exact Mass | 446.30300 |
| PSA | 91.67000 |
| LogP | 4.89130 |
| Index of Refraction | 1.527 |
| InChIKey | DFWCSGAJNBBVMR-JYHUSGTRSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2(C)C3C(=O)CC4C(C)(C)C(O)CCC4(C)C3C(=O)CC12C |
|
~%
3-hydroxy-4,4,1... CAS#:5399-41-7 |
| Literature: McGhie et al. Chemistry and Industry (London, United Kingdom), 1951 , p. 1165 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |