3-[4-[3-(3,4,5-trimethoxybenzoyl)oxypropyl]piperazin-1-yl]propyl 3,4,5-trimethoxybenzoate
Modify Date: 2025-09-24 09:41:28
![3-[4-[3-(3,4,5-trimethoxybenzoyl)oxypropyl]piperazin-1-yl]propyl 3,4,5-trimethoxybenzoate Structure](https://image.chemsrc.com/caspic/099/54-02-4.png)
3-[4-[3-(3,4,5-trimethoxybenzoyl)oxypropyl]piperazin-1-yl]propyl 3,4,5-trimethoxybenzoate structure
|
Common Name | 3-[4-[3-(3,4,5-trimethoxybenzoyl)oxypropyl]piperazin-1-yl]propyl 3,4,5-trimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 54-02-4 | Molecular Weight | 590.66200 | |
| Density | 1.168g/cm3 | Boiling Point | 634.9ºC at 760 mmHg | |
| Molecular Formula | C30H42N2O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.8ºC | |
| Name | 3-[4-[3-(3,4,5-trimethoxybenzoyl)oxypropyl]piperazin-1-yl]propyl 3,4,5-trimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 634.9ºC at 760 mmHg |
| Molecular Formula | C30H42N2O10 |
| Molecular Weight | 590.66200 |
| Flash Point | 337.8ºC |
| Exact Mass | 590.28400 |
| PSA | 114.46000 |
| LogP | 3.02560 |
| Index of Refraction | 1.53 |
| InChIKey | MOCOKCQYOSGWMM-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)OCCCN2CCN(CCCOC(=O)c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ST 7092 |
| N.N'-Bis-<3-(3,4,5-trimethoxy-benzoyloxy)-propyl>-piperazin |
| Benzoic acid,3,4,5-trimethoxy-,1,4-piperazinediyldi-3,1-propanediyl ester |
| 3,4,5-trimethoxy-benzoic acid 3,3'-piperazine-1,4-diyl-dipropyl ester |