3H-Pyrazol-3-one,2-(4-fluorophenyl)-1,2-dihydro-1,5-dimethyl- structure
|
Common Name | 3H-Pyrazol-3-one,2-(4-fluorophenyl)-1,2-dihydro-1,5-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 5400-60-2 | Molecular Weight | 206.21600 | |
| Density | 1.234g/cm3 | Boiling Point | 295.9ºC at 760mmHg | |
| Molecular Formula | C11H11FN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.8ºC | |
| Name | 2-(4-fluorophenyl)-1,5-dimethylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 295.9ºC at 760mmHg |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.21600 |
| Flash Point | 132.8ºC |
| Exact Mass | 206.08600 |
| PSA | 26.93000 |
| LogP | 1.62350 |
| Index of Refraction | 1.566 |
| InChIKey | DPSOQADTQNTSSG-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)n(-c2ccc(F)cc2)n1C |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3H-Pyrazol-3-one,2-(4-fluorophenyl)-1,2-dihydro-1,5-dimethyl |
| 4-Fluoroantipyrine |
| 1-(4'-Fluorphenyl)-2,3-dimethyl-5-pyrazolon |
| 2-(4-fluorophenyl)-1,5-dimethyl-1H-pyrazol-3(2H)-one |
| 2-(4-fluoro-phenyl)-1,5-dimethyl-1,2-dihydro-pyrazol-3-one |