4-Methyl-2-(4-methylphenyl)-1,3-thiazole-5-carboxylic acid structure
|
Common Name | 4-Methyl-2-(4-methylphenyl)-1,3-thiazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 54001-13-7 | Molecular Weight | 233.28600 | |
| Density | 1.278g/cm3 | Boiling Point | 428.6ºC at 760mmHg | |
| Molecular Formula | C12H11NO2S | Melting Point | 262-263.5ºC | |
| MSDS | N/A | Flash Point | 213ºC | |
| Name | 4-Methyl-2-(4-methylphenyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 428.6ºC at 760mmHg |
| Melting Point | 262-263.5ºC |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.28600 |
| Flash Point | 213ºC |
| Exact Mass | 233.05100 |
| PSA | 78.43000 |
| LogP | 3.12510 |
| Index of Refraction | 1.617 |
| InChIKey | AJUWPIKGVOGPRL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nc(C)c(C(=O)O)s2)cc1 |
| HS Code | 2934100090 |
|---|
|
~89%
4-Methyl-2-(4-m... CAS#:54001-13-7 |
| Literature: KATHOLIEKE UNIVERSITEIT LEUVEN, K.U. LEUVEN Randamp;;D; reMYND; GRIFFIOEN, Gerard; VAN DOOREN, Tom; ROJAS DE LA PARRA, Veronica; MARCHAND, Arnaud; ALLASIA, Sara; KILONDA, Amuri; CHALTIN, Patrick Patent: WO2010/142801 A1, 2010 ; Location in patent: Page/Page column 156 ; WO 2010/142801 A1 |
|
~%
4-Methyl-2-(4-m... CAS#:54001-13-7 |
| Literature: Archiv der Pharmazie, , vol. 314, # 9 p. 744 - 750 |
|
~%
4-Methyl-2-(4-m... CAS#:54001-13-7 |
| Literature: Justus Liebigs Annalen der Chemie, , p. 1195 - 1205 |
|
~%
4-Methyl-2-(4-m... CAS#:54001-13-7 |
| Literature: Archiv der Pharmazie, , vol. 314, # 9 p. 744 - 750 |
|
~%
4-Methyl-2-(4-m... CAS#:54001-13-7 |
| Literature: Archiv der Pharmazie, , vol. 314, # 9 p. 744 - 750 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-methyl-2-(4-methylphenyl)-1,3-thiazol-5-carboxylic acid |
| 4-methyl-2-p-tolylthiazol-5-carboxylic acid |
| 4-Methyl-2-(4-methylphenyl)thiazole-5-carboxylicacid |
| 4-methyl-2-p-tolylthiazole-5-carboxylic acid |