5-acetamido-3-amino-2-nitrobenzoic acid structure
|
Common Name | 5-acetamido-3-amino-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 54002-31-2 | Molecular Weight | 239.18500 | |
| Density | 1.603g/cm3 | Boiling Point | 594.4ºC at 760mmHg | |
| Molecular Formula | C9H9N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.3ºC | |
| Name | 5-acetamido-3-amino-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.603g/cm3 |
|---|---|
| Boiling Point | 594.4ºC at 760mmHg |
| Molecular Formula | C9H9N3O5 |
| Molecular Weight | 239.18500 |
| Flash Point | 313.3ºC |
| Exact Mass | 239.05400 |
| PSA | 138.24000 |
| LogP | 2.01100 |
| Index of Refraction | 1.709 |
| InChIKey | MUMKZTDIVDHANZ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(N)c([N+](=O)[O-])c(C(=O)O)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,5-(acetylamino)-3-amino-2-nitro |
| 5-(Acetylamino)-3-amino-2-nitrobenzoic acid |
| 5-Acetamido-3-amino-2-nitrobenzoesaeure |