1,2,3-Propanetricarboxylicacid, 1,2,3-tris(1,3-dimethylbutyl) ester structure
|
Common Name | 1,2,3-Propanetricarboxylicacid, 1,2,3-tris(1,3-dimethylbutyl) ester | ||
|---|---|---|---|---|
| CAS Number | 5401-00-3 | Molecular Weight | 428.60300 | |
| Density | 0.979g/cm3 | Boiling Point | 469.1ºC at 760mmHg | |
| Molecular Formula | C24H44O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.1ºC | |
| Name | tris(4-methylpentan-2-yl) propane-1,2,3-tricarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.979g/cm3 |
|---|---|
| Boiling Point | 469.1ºC at 760mmHg |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.60300 |
| Flash Point | 195.1ºC |
| Exact Mass | 428.31400 |
| PSA | 78.90000 |
| LogP | 5.31620 |
| Index of Refraction | 1.452 |
| InChIKey | XBNWCMUBZMWBGY-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)OC(=O)CC(CC(=O)OC(C)CC(C)C)C(=O)OC(C)CC(C)C |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| propane-1,2,3-tricarboxylic acid tris-(1,3-dimethyl-butyl ester) |
| Propan-1,2,3-tricarbonsaeure-tris-(1,3-dimethyl-butylester) |
| 1,2,3-Propanetricarboxylicacid,1,2,3-tris(1,3-dimethylbutyl) ester |