6-(4-aminophenyl)sulfonylpyridin-3-amine structure
|
Common Name | 6-(4-aminophenyl)sulfonylpyridin-3-amine | ||
|---|---|---|---|---|
| CAS Number | 5401-26-3 | Molecular Weight | 249.28900 | |
| Density | 1.13g/cm3 | Boiling Point | 588.4ºC at 760 mmHg | |
| Molecular Formula | C11H11N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.9ºC | |
| Name | 6-(4-aminophenyl)sulfonylpyridin-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 588.4ºC at 760 mmHg |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.28900 |
| Flash Point | 201.9ºC |
| Exact Mass | 249.05700 |
| PSA | 107.45000 |
| LogP | 3.32200 |
| Index of Refraction | 1.588 |
| InChIKey | XVMSFILGAMDHEY-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(N)cn2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2933399090 |
|---|
|
~%
6-(4-aminopheny... CAS#:5401-26-3 |
| Literature: Roblin; Williams; Anderson Journal of the American Chemical Society, 1941 , vol. 63, p. 1930,1931 |
|
~%
6-(4-aminopheny... CAS#:5401-26-3 |
| Literature: Dohrn; Laubereau Patent: US2456258 , 1940 ; |
|
~%
6-(4-aminopheny... CAS#:5401-26-3 |
| Literature: Dohrn; Laubereau Patent: US2456258 , 1940 ; |
|
~%
6-(4-aminopheny... CAS#:5401-26-3 |
| Literature: Dohrn; Laubereau Patent: US2456258 , 1940 ; |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 6-sulfanilyl-[3]pyridylamine |
| 6-((4-Aminophenyl)sulfonyl)-3-pyridinamine |
| 5-Amino-2-sulfanilylpyridine |
| Pyridinine |
| Pyridinin |
| 5-Aminopyridyl-4'-aminophenylsulfone |
| Pyridine,5-amino-2-sulfanilyl |