4-bromo-3-methyl-benzenesulfonic acid structure
|
Common Name | 4-bromo-3-methyl-benzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 5402-74-4 | Molecular Weight | 274.08700 | |
| Density | 1.735g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H7BrNaO3S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,4-bromo-3-methylbenzenesulfonic acid |
|---|
| Density | 1.735g/cm3 |
|---|---|
| Molecular Formula | C7H7BrNaO3S+ |
| Molecular Weight | 274.08700 |
| Exact Mass | 272.92000 |
| PSA | 62.75000 |
| LogP | 3.08500 |
| Index of Refraction | 1.599 |
| InChIKey | GSQLWTOHPOMWEZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(S(=O)(=O)O)ccc1Br.[Na+] |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |