3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole
Modify Date: 2026-07-04 08:34:38
![3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole Structure](https://www.chemsrc.com/extcaspic/484/540468-98-2.png)
3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole structure
|
Common Name | 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole | ||
|---|---|---|---|---|
| CAS Number | 540468-98-2 | Molecular Weight | 268.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10BrN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10BrN3O |
|---|---|
| Molecular Weight | 268.11 |
| InChIKey | NAAUMDCCEKKZCI-UHFFFAOYSA-N |
| SMILES | Cn1cnc(COc2cccc(Br)c2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole? |
| A: The English name of 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole is 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole. |
| Q: What is the molecular weight of 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole? |
| A: Molecular weight of 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole is 268.11. |
| Q: What is the CAS number of 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole? |
| A: CAS number of 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole is 540468-98-2. |
| Q: What is the molecular formula of 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole? |
| A: Molecular formula of 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole is C10H10BrN3O. |
| Q: What is the Chinese name of 540468-98-2? |
| A: Chinese name of 540468-98-2 is 540468-98-2. |
| Q: What is the SMILES notation of 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole? |
| A: SMILES notation of 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole is Cn1cnc(COc2cccc(Br)c2)n1. |
| Q: What is the InChIKey of 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole? |
| A: InChIKey of 3-(3-Bromophenoxymethyl)-1-methyl-1H-[1,2,4]triazole is NAAUMDCCEKKZCI-UHFFFAOYSA-N. |