3-[(5-nitro-2-furyl)methylideneamino]thiazolidin-2-one
Modify Date: 2025-09-21 16:11:17
![3-[(5-nitro-2-furyl)methylideneamino]thiazolidin-2-one Structure](https://image.chemsrc.com/caspic/036/5407-75-0.png)
3-[(5-nitro-2-furyl)methylideneamino]thiazolidin-2-one structure
|
Common Name | 3-[(5-nitro-2-furyl)methylideneamino]thiazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 5407-75-0 | Molecular Weight | 241.22400 | |
| Density | 1.68g/cm3 | Boiling Point | 403.2ºC at 760 mmHg | |
| Molecular Formula | C8H7N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.6ºC | |
| Name | 3-(5-nitro-furfurylidenamino)-thiazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 403.2ºC at 760 mmHg |
| Molecular Formula | C8H7N3O4S |
| Molecular Weight | 241.22400 |
| Flash Point | 197.6ºC |
| Exact Mass | 241.01600 |
| PSA | 116.93000 |
| LogP | 2.15160 |
| Index of Refraction | 1.725 |
| InChIKey | DBSBTACIBFIPGL-WEVVVXLNSA-N |
| SMILES | O=C1SCCN1N=Cc1ccc([N+](=O)[O-])o1 |
| HS Code | 2934999090 |
|---|
|
~%
3-[(5-nitro-2-f... CAS#:5407-75-0 |
| Literature: Michels; Gever Journal of the American Chemical Society, 1956 , vol. 78, p. 5349 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(5-Nitro-furfurylidenamino)-thiazolidin-2-on |