2-methoxy-1,3,5-trinitro-4-tert-butyl-benzene structure
|
Common Name | 2-methoxy-1,3,5-trinitro-4-tert-butyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 5407-92-1 | Molecular Weight | 299.23700 | |
| Density | 1.387g/cm3 | Boiling Point | 438.5ºC at 760 mmHg | |
| Molecular Formula | C11H13N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
| Name | 2-tert-butyl-4-methoxy-1,3,5-trinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 438.5ºC at 760 mmHg |
| Molecular Formula | C11H13N3O7 |
| Molecular Weight | 299.23700 |
| Flash Point | 191.6ºC |
| Exact Mass | 299.07500 |
| PSA | 146.69000 |
| LogP | 4.28690 |
| Index of Refraction | 1.571 |
| InChIKey | PCVDYIFRMYOZED-UHFFFAOYSA-N |
| SMILES | COc1c([N+](=O)[O-])cc([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-] |
|
~%
2-methoxy-1,3,5... CAS#:5407-92-1 |
| Literature: Carpenter et al. Journal of Organic Chemistry, 1951 , vol. 16, p. 586,606 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-tert-butyl-2,4,6-trinitro-anisole |