4,6-dimethyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile structure
|
Common Name | 4,6-dimethyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 5407-93-2 | Molecular Weight | 193.15900 | |
| Density | 1.38g/cm3 | Boiling Point | 314.6ºC at 760 mmHg | |
| Molecular Formula | C8H7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144ºC | |
| Name | 2,4-dimethyl-6-heptanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 314.6ºC at 760 mmHg |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.15900 |
| Flash Point | 144ºC |
| Exact Mass | 193.04900 |
| PSA | 102.47000 |
| LogP | 1.29478 |
| Index of Refraction | 1.568 |
| InChIKey | BRVIZBAZAJBTFY-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(=O)c(C#N)c(C)c1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-Dimethyl-2-Heptanon |
| 5-Cyan-2,4-dimethyl-3-nitro-pyrid-6-on |
| iso-diisobutyl ketone |
| 2-hydroxy-4,6-dimethyl-5-nitro-nicotinonitrile |
| 3-Cyan-4,6-dimethyl-5-nitro-pyrid-2-on |
| 4,6-dimethyl-heptan-2-one |
| 4,6-Dimethyl-2-hydroxy-5-nitro-nicotinonitril |
| 2-Heptanone,4,6-dimethyl |
| 4,6-Dimethyl-heptan-2-on |
| 4,6-Dimethyl-2-heptanone |