norbornenylethyltrichlorosilane
norbornenylethyltrichlorosilane structure
|
Common Name | norbornenylethyltrichlorosilane | ||
|---|---|---|---|---|
| CAS Number | 54076-73-2 | Molecular Weight | 255.64400 | |
| Density | 1.22 | Boiling Point | 75ºC/10mm | |
| Molecular Formula | C9H13Cl3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.932ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(bicycloheptenyl)ethyl]trichlorosilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.22 |
|---|---|
| Boiling Point | 75ºC/10mm |
| Molecular Formula | C9H13Cl3Si |
| Molecular Weight | 255.64400 |
| Flash Point | 122.932ºC |
| Exact Mass | 253.98500 |
| LogP | 4.24400 |
| Index of Refraction | 1.519 |
| InChIKey | ALVNNCNXYMELRG-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(Cl)CCC1CC2C=CC1C2 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2-Bicyclo[2.2.1]hept-5-en-2-ylethyl)trichlorosilane |
| NORBORNENYLETHYLTRICHLOROSILANE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of [(bicycloheptenyl)ethyl]trichlorosilane? |
| A: Molecular weight of [(bicycloheptenyl)ethyl]trichlorosilane is 255.64400. |
| Q: What is the boiling point of [(bicycloheptenyl)ethyl]trichlorosilane? |
| A: Boiling point of [(bicycloheptenyl)ethyl]trichlorosilane is 75ºC/10mm. |
| Q: What is the SMILES notation of [(bicycloheptenyl)ethyl]trichlorosilane? |
| A: SMILES notation of [(bicycloheptenyl)ethyl]trichlorosilane is Cl[Si](Cl)(Cl)CCC1CC2C=CC1C2. |
| Q: What is the English name of [(bicycloheptenyl)ethyl]trichlorosilane? |
| A: The English name of [(bicycloheptenyl)ethyl]trichlorosilane is [(bicycloheptenyl)ethyl]trichlorosilane. |
| Q: What is the InChIKey of [(bicycloheptenyl)ethyl]trichlorosilane? |
| A: InChIKey of [(bicycloheptenyl)ethyl]trichlorosilane is ALVNNCNXYMELRG-UHFFFAOYSA-N. |
| Q: What is the CAS number of [(bicycloheptenyl)ethyl]trichlorosilane? |
| A: CAS number of [(bicycloheptenyl)ethyl]trichlorosilane is 54076-73-2. |
| Q: What is the LogP of [(bicycloheptenyl)ethyl]trichlorosilane? |
| A: LogP of [(bicycloheptenyl)ethyl]trichlorosilane is 4.24400. |
| Q: What is the molecular formula of [(bicycloheptenyl)ethyl]trichlorosilane? |
| A: Molecular formula of [(bicycloheptenyl)ethyl]trichlorosilane is C9H13Cl3Si. |
| Q: What English synonyms does [(bicycloheptenyl)ethyl]trichlorosilane have? |
| A: English synonyms of [(bicycloheptenyl)ethyl]trichlorosilane: (2-Bicyclo[2.2.1]hept-5-en-2-ylethyl)trichlorosilane, NORBORNENYLETHYLTRICHLOROSILANE. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |