2-(3-(2,4-dichlorophenoxy)-2-hydroxypropyl)benzo[d]isothiazol-3(2H)-one 1,1-dioxide structure
|
Common Name | 2-(3-(2,4-dichlorophenoxy)-2-hydroxypropyl)benzo[d]isothiazol-3(2H)-one 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 540770-85-2 | Molecular Weight | 402.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13Cl2NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-(2,4-dichlorophenoxy)-2-hydroxypropyl)benzo[d]isothiazol-3(2H)-one 1,1-dioxide |
|---|
| Molecular Formula | C16H13Cl2NO5S |
|---|---|
| Molecular Weight | 402.2 |
| InChIKey | UVTOFWFHRJHJGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(S2(=O)=O)CC(COC3=C(C=C(C=C3)Cl)Cl)O |
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|