9-Acridinecarbonitrile,6-chloro-2-methoxy- structure
|
Common Name | 9-Acridinecarbonitrile,6-chloro-2-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 5408-25-3 | Molecular Weight | 268.69800 | |
| Density | 1.38g/cm3 | Boiling Point | 485.5ºC at 760mmHg | |
| Molecular Formula | C15H9ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.4ºC | |
| Name | 6-chloro-2-methoxyacridine-9-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 485.5ºC at 760mmHg |
| Molecular Formula | C15H9ClN2O |
| Molecular Weight | 268.69800 |
| Flash Point | 247.4ºC |
| Exact Mass | 268.04000 |
| PSA | 45.91000 |
| LogP | 3.92168 |
| Index of Refraction | 1.704 |
| InChIKey | SYBQUGRVQBMZDM-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(C#N)c2c1 |
| HS Code | 2933990090 |
|---|
|
~%
9-Acridinecarbo... CAS#:5408-25-3 |
| Literature: Bras Zhurnal Obshchei Khimii, 1941 , vol. 11, p. 851,853 Chem.Abstr., 1942 , p. 4122 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Chlor-2-methoxy-acridin-9-carbonitril |
| 3-Chloro-7-methoxy-9-cyanoacridine |
| 6-chloro-2-methoxy-acridine-9-carbonitrile |