2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]sulfanyl]-1-carbazol-9-yl-ethanone structure
|
Common Name | 2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]sulfanyl]-1-carbazol-9-yl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 5409-52-9 | Molecular Weight | 276.20200 | |
| Density | 1.076g/cm3 | Boiling Point | 340.7ºC at 760 mmHg | |
| Molecular Formula | C13H19Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.9ºC | |
| Name | 1-(4-chloro-phenyl)-3-diethylamino-propan-1-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.076g/cm3 |
|---|---|
| Boiling Point | 340.7ºC at 760 mmHg |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.20200 |
| Flash Point | 159.9ºC |
| Exact Mass | 275.08400 |
| PSA | 20.31000 |
| LogP | 4.05660 |
| Index of Refraction | 1.523 |
| InChIKey | FQWOZIQXCXXAGL-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCC(=O)c1ccc(Cl)cc1.Cl |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Cytotoxicity evaluated against P388 cells.
Source: ChEMBL
Target: P388
External Id: CHEMBL753298
|
|
Name: Cytotoxicity evaluated against L1210 cells.
Source: ChEMBL
Target: L1210
External Id: CHEMBL708995
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-(4-Chlor-phenyl)-3-diaethylamino-propan-1-on,Hydrochlorid |
| 1-(4-Chlor-phenyl)-3-diaethylamino-propan-1-on |
| 1-Propanone,1-(4-chlorophenyl)-3-(diethylamino) |
| 1-(4-chlorophenyl)-3-diethylamino-propane-1-one hydrochloride |
| 1-(4-chlorophenyl)-3-diethylamino-propan-1-one |