1,3-Benzenedisulfonicacid, 4-chloro-, S1,S3,1,3-tetrahydrazide structure
|
Common Name | 1,3-Benzenedisulfonicacid, 4-chloro-, S1,S3,1,3-tetrahydrazide | ||
|---|---|---|---|---|
| CAS Number | 5409-74-5 | Molecular Weight | 300.74300 | |
| Density | 1.699g/cm3 | Boiling Point | 570.6ºC at 760mmHg | |
| Molecular Formula | C6H9ClN4O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.9ºC | |
| Name | 4-chlorobenzene-1,3-disulfonohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.699g/cm3 |
|---|---|
| Boiling Point | 570.6ºC at 760mmHg |
| Molecular Formula | C6H9ClN4O4S2 |
| Molecular Weight | 300.74300 |
| Flash Point | 298.9ºC |
| Exact Mass | 299.97500 |
| PSA | 161.14000 |
| LogP | 2.98800 |
| Index of Refraction | 1.64 |
| InChIKey | SGAFLWBJMFLSOM-UHFFFAOYSA-N |
| SMILES | NNS(=O)(=O)c1ccc(Cl)c(S(=O)(=O)NN)c1 |
|
~25%
1,3-Benzenedisu... CAS#:5409-74-5 |
| Literature: Donia, Shafie G.; Shams, N.; El-Raman, T. Abd Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 117 - 120 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Chlorobenzene-2,4-bis-sulphonic acid bishydrazide |
| 4-Chlor-benzol-1,3-disulfonsaeure-dihydrazid |
| 4-chloro-benzene-1,3-disulfonic acid dihydrazide |