1-(2-bromoethoxy)-4-(chloromethyl)-2-nitro-benzene structure
|
Common Name | 1-(2-bromoethoxy)-4-(chloromethyl)-2-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 5409-77-8 | Molecular Weight | 294.53000 | |
| Density | 1.612g/cm3 | Boiling Point | 418.7ºC at 760 mmHg | |
| Molecular Formula | C9H9BrClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207ºC | |
| Name | 1-(2-bromoethoxy)-4-(chloromethyl)-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.612g/cm3 |
|---|---|
| Boiling Point | 418.7ºC at 760 mmHg |
| Molecular Formula | C9H9BrClNO3 |
| Molecular Weight | 294.53000 |
| Flash Point | 207ºC |
| Exact Mass | 292.94500 |
| PSA | 55.05000 |
| LogP | 3.63050 |
| Index of Refraction | 1.589 |
| InChIKey | AKFSAABIFZPNMC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(CCl)ccc1OCCBr |
|
~%
1-(2-bromoethox... CAS#:5409-77-8 |
| Literature: Kulka; Van Stryk Canadian Journal of Chemistry, 1955 , vol. 33, p. 1130,1135 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| (2-Brom-aethyl)-(4-chlor-2-methyl-phenyl)-aether |
| (2-Brom-aethyl)-(4-chlormethyl-2-nitro-phenyl)-aether |
| 2-(2-Methyl-4-chlorphenoxy)-ethylbromid |
| Benzene,1-(2-bromoethoxy)-4-chloro-2-methyl |
| (2-bromo-ethyl)-(4-chloro-2-methyl-phenyl)-ether |
| (2-bromo-ethyl)-(4-chloromethyl-2-nitro-phenyl)-ether |
| 1-(2-bromoethoxy)-4-chloro-2-methyl-benzene |