Benzenesulfonic acid,3,4-dichloro-, 2-chloroethyl ester structure
|
Common Name | Benzenesulfonic acid,3,4-dichloro-, 2-chloroethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5409-78-9 | Molecular Weight | 289.56300 | |
| Density | 1.529g/cm3 | Boiling Point | 427.8ºC at 760 mmHg | |
| Molecular Formula | C8H7Cl3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.5ºC | |
| Name | 2-chloroethyl 3,4-dichlorobenzenesulfonate |
|---|
| Density | 1.529g/cm3 |
|---|---|
| Boiling Point | 427.8ºC at 760 mmHg |
| Molecular Formula | C8H7Cl3O3S |
| Molecular Weight | 289.56300 |
| Flash Point | 212.5ºC |
| Exact Mass | 287.91800 |
| PSA | 51.75000 |
| LogP | 4.01830 |
| Index of Refraction | 1.558 |
| InChIKey | MPIPDBAJZFPTNT-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OCCCl)c1ccc(Cl)c(Cl)c1 |
|
~%
Benzenesulfonic... CAS#:5409-78-9 |
| Literature: Kulka Journal of the American Chemical Society, 1950 , vol. 72, p. 1215,1217 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |