1,4-dichloro-2,5-bis(2-chloroethoxymethyl)benzene structure
|
Common Name | 1,4-dichloro-2,5-bis(2-chloroethoxymethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 5409-85-8 | Molecular Weight | 332.05000 | |
| Density | 1.341g/cm3 | Boiling Point | 395.1ºC at 760 mmHg | |
| Molecular Formula | C12H14Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.7ºC | |
| Name | 2,3-bis-chloromethyl-oxirane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 395.1ºC at 760 mmHg |
| Molecular Formula | C12H14Cl4O2 |
| Molecular Weight | 332.05000 |
| Flash Point | 137.7ºC |
| Exact Mass | 329.97500 |
| PSA | 18.46000 |
| LogP | 4.50420 |
| Index of Refraction | 1.539 |
| InChIKey | XCBCXWOBSVKKII-UHFFFAOYSA-N |
| SMILES | ClCCOCc1cc(Cl)c(COCCCl)cc1Cl |
|
~%
1,4-dichloro-2,... CAS#:5409-85-8 |
| Literature: Kulka; Van Stryk Canadian Journal of Chemistry, 1955 , vol. 33, p. 1130,1135 |
|
~%
1,4-dichloro-2,... CAS#:5409-85-8 |
| Literature: Kulka; Van Stryk Canadian Journal of Chemistry, 1955 , vol. 33, p. 1130,1135 |
|
~%
1,4-dichloro-2,... CAS#:5409-85-8 |
| Literature: Kulka; Van Stryk Canadian Journal of Chemistry, 1955 , vol. 33, p. 1130,1135 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,4-dichloro-2,5-bis-(2-chloro-ethoxymethyl)-benzene |
| 1,4-Dichlor-2,3-epoxybutan |
| 1,4-Dichlor-2,5-bis-(2-chlor-aethoxymethyl)-benzol |
| Butane,1,4-dichloro-2,3-epoxy |
| 1,4-Dichloro-2,3-epoxybutane |
| Oxirane,2,3-bis(chloromethyl) |
| 1,4-DICHLOROBUTENE-2,3-EPOXIDE |
| cis-1,4-dichloro-2,3-epoxybutane |
| 2,3-Bis-chlormethyl-oxiran |