2-ethyl-2-phenylpropanedioyl dichloride structure
|
Common Name | 2-ethyl-2-phenylpropanedioyl dichloride | ||
|---|---|---|---|---|
| CAS Number | 54095-15-7 | Molecular Weight | 245.10200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethyl-2-phenylpropanedioyl dichloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10Cl2O2 |
|---|---|
| Molecular Weight | 245.10200 |
| Exact Mass | 244.00600 |
| PSA | 34.14000 |
| LogP | 2.86520 |
| InChIKey | NXROHJABHCSTOK-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)Cl)(C(=O)Cl)c1ccccc1 |
|
~%
2-ethyl-2-pheny... CAS#:54095-15-7 |
| Literature: University of Florida Patent: US5223528 A1, 1993 ; |
|
~51%
2-ethyl-2-pheny... CAS#:54095-15-7 |
| Literature: Cowden; Jacobsen Australian Journal of Chemistry, 1982 , vol. 35, # 4 p. 795 - 797 |
|
~%
2-ethyl-2-pheny... CAS#:54095-15-7 |
| Literature: Treston; Hooper Arzneimittel-Forschung/Drug Research, 1985 , vol. 35, # 11 p. 1627 - 1629 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Aethyl-phenyl-malonsaeuredichlorid |
| ethyl-phenyl-malonyl dichloride |
| 2-ethyl-2-phenylmalonyldichloride |
| ethyl-phenyl-malonyl chloride |
| Aethyl-phenyl-malonylchlorid |
| Propanedioyl dichloride,ethylphenyl |
| Phenyl-ethyl-malonsaeure-dichlorid |