2-(4-arsono-2-nitro-phenoxy)acetic acid structure
|
Common Name | 2-(4-arsono-2-nitro-phenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 5410-42-4 | Molecular Weight | 321.07300 | |
| Density | N/A | Boiling Point | 679.1ºC at 760 mmHg | |
| Molecular Formula | C8H8AsNO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 364.5ºC | |
| Name | 2-(4-arsono-2-nitrophenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 679.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H8AsNO8 |
| Molecular Weight | 321.07300 |
| Flash Point | 364.5ºC |
| Exact Mass | 320.94700 |
| PSA | 149.88000 |
| InChIKey | ALBXDACZLOYOOS-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc([As](=O)(O)O)cc1[N+](=O)[O-] |
|
~%
2-(4-arsono-2-n... CAS#:5410-42-4 |
| Literature: Christiansen Journal of the American Chemical Society, 1922 , vol. 44, p. 2339 |
|
~%
2-(4-arsono-2-n... CAS#:5410-42-4 |
| Literature: Sweet; Hamilton Journal of the American Chemical Society, 1934 , vol. 56, p. 2409,2411 |
|
~%
2-(4-arsono-2-n... CAS#:5410-42-4 |
| Literature: Sweet; Hamilton Journal of the American Chemical Society, 1934 , vol. 56, p. 2409,2411 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-Nitro-4-carbomethoxy-phenylarsonsaeure |
| (4-arsono-2-nitro-phenoxy)-acetic acid |
| HMS2856B22 |
| 2-Nitro-phenoxyessigsaeure-arsonsaeure-(4) |
| (4-Arsono-2-nitro-phenoxy)-essigsaeure |