[tert-butyl(phenyl)phosphoryl] thiocyanate structure
|
Common Name | [tert-butyl(phenyl)phosphoryl] thiocyanate | ||
|---|---|---|---|---|
| CAS Number | 54100-41-3 | Molecular Weight | 239.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14NOPS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [tert-butyl(phenyl)phosphoryl] thiocyanate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14NOPS |
|---|---|
| Molecular Weight | 239.27400 |
| Exact Mass | 239.05300 |
| PSA | 75.97000 |
| LogP | 3.60278 |
| InChIKey | POUXPOJUWJAEFH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(=O)(SC#N)c1ccccc1 |
|
~%
[tert-butyl(phe... CAS#:54100-41-3 |
| Literature: Lopusinski, Andrzej; Luczak, Lech; Brzezinska, Ewa Phosphorus and Sulfur and the Related Elements, 1987 , vol. 31, p. 101 - 108 |
|
~%
[tert-butyl(phe... CAS#:54100-41-3 |
| Literature: Lopusinski,A. et al. Justus Liebigs Annalen der Chemie, 1977 , p. 924 - 947 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Phosphinic thiocyanate,(1,1-dimethylethyl)phenyl |
| tert.Butyl(phenyl)phosphinothiocyanatidat |
| tert-Butyl(phenyl)phosphinoyl-thiocyanat |