dimethyl quinoxaline-2,3-dicarboxylate
dimethyl quinoxaline-2,3-dicarboxylate structure
|
Common Name | dimethyl quinoxaline-2,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 54107-99-2 | Molecular Weight | 246.21900 | |
| Density | 1.325g/cm3 | Boiling Point | 331.2ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dimethyl quinoxaline-2,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 331.2ºC at 760 mmHg |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.21900 |
| Flash Point | 154.1ºC |
| Exact Mass | 246.06400 |
| PSA | 78.38000 |
| LogP | 1.20300 |
| Index of Refraction | 1.603 |
| InChIKey | KJGMTJLKKFWUBJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1nc2ccccc2nc1C(=O)OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 4 | |
CAS#:95-54-5
CAS#:762-42-5
CAS#:146651-75-4
CAS#:67-56-1
CAS#:6924-99-8
CAS#:133-47-1
CAS#:273-13-2
CAS#:273-15-4![furo[3,4-b]quinoxaline-1,3-dione structure](https://image.chemsrc.com/caspic/022/5660-34-4.png)
CAS#:5660-34-4![(2,4-dioxo-1H-benzo[g]pteridin-3-yl) benzenesulfonate structure](https://image.chemsrc.com/caspic/083/54107-98-1.png)
CAS#:54107-98-1![Benzo[g]pteridine-2,4(1H,3H)-dione, 3-hydroxy structure](https://image.chemsrc.com/caspic/120/54108-08-6.png)
CAS#:54108-08-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Chinoxalin-2,3-dicarbonsaeure-dimethylester |
| methyl quinoxalinedicarboxylate |
| methyl 2,3-quinoxalinedicarboxylate |
| quinoxaline-2,3-dicarboxylic acid dimethyl ester |
| 2,3-Dimethoxycarbonyl-chinoxalin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of dimethyl quinoxaline-2,3-dicarboxylate? |
| A: LogP of dimethyl quinoxaline-2,3-dicarboxylate is 1.20300. |
| Q: What is the molecular formula of dimethyl quinoxaline-2,3-dicarboxylate? |
| A: Molecular formula of dimethyl quinoxaline-2,3-dicarboxylate is C12H10N2O4. |
| Q: What are the upstream materials of dimethyl quinoxaline-2,3-dicarboxylate? |
| A: Related upstream materials(CAS) of dimethyl quinoxaline-2,3-dicarboxylate: 95-54-5;762-42-5;146651-75-4;67-56-1;6924-99-8;133-47-1;273-13-2;273-15-4. |
| Q: What is the boiling point of dimethyl quinoxaline-2,3-dicarboxylate? |
| A: Boiling point of dimethyl quinoxaline-2,3-dicarboxylate is 331.2ºC at 760 mmHg. |
| Q: What is the molecular weight of dimethyl quinoxaline-2,3-dicarboxylate? |
| A: Molecular weight of dimethyl quinoxaline-2,3-dicarboxylate is 246.21900. |
| Q: What is the Chinese name of 54107-99-2? |
| A: Chinese name of 54107-99-2 is 54107-99-2. |
| Q: What is the English name of dimethyl quinoxaline-2,3-dicarboxylate? |
| A: The English name of dimethyl quinoxaline-2,3-dicarboxylate is dimethyl quinoxaline-2,3-dicarboxylate. |
| Q: What is the polar surface area (PSA) of dimethyl quinoxaline-2,3-dicarboxylate? |
| A: Polar surface area (PSA) of dimethyl quinoxaline-2,3-dicarboxylate is 78.38000. |
| Q: What English synonyms does dimethyl quinoxaline-2,3-dicarboxylate have? |
| A: English synonyms of dimethyl quinoxaline-2,3-dicarboxylate: Chinoxalin-2,3-dicarbonsaeure-dimethylester, methyl quinoxalinedicarboxylate, methyl 2,3-quinoxalinedicarboxylate, quinoxaline-2,3-dicarboxylic acid dimethyl ester, 2,3-Dimethoxycarbonyl-chinoxalin. |
| Q: What is the InChIKey of dimethyl quinoxaline-2,3-dicarboxylate? |
| A: InChIKey of dimethyl quinoxaline-2,3-dicarboxylate is KJGMTJLKKFWUBJ-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |