N-2',4',6'-trimethoxyphenacyl bromide structure
|
Common Name | N-2',4',6'-trimethoxyphenacyl bromide | ||
|---|---|---|---|---|
| CAS Number | 54109-15-8 | Molecular Weight | 289.12300 | |
| Density | 1.402g/cm3 | Boiling Point | 391.3ºC at 760mmHg | |
| Molecular Formula | C11H13BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.5ºC | |
| Name | 2-bromo-1-(2,4,6-trimethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 391.3ºC at 760mmHg |
| Molecular Formula | C11H13BrO4 |
| Molecular Weight | 289.12300 |
| Flash Point | 190.5ºC |
| Exact Mass | 288.00000 |
| PSA | 44.76000 |
| LogP | 2.29000 |
| Index of Refraction | 1.533 |
| InChIKey | MWODTVPKPLLOOE-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C(=O)CBr)c(OC)c1 |
| HS Code | 2914700090 |
|---|
|
~%
N-2',4',6'-trim... CAS#:54109-15-8 |
| Literature: Lau, Johnson; Huang, Jiann-Jyh Patent: US2011/230486 A1, 2011 ; Location in patent: Page/Page column 29 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-bromo-1-(2,4,6-trimethoxy-phenyl)-ethanone |
| Ethanone,2-bromo-1-(2,4,6-trimethoxyphenyl) |
| N-2',4',6'-Trimethoxyphenacyl bromide |
| 2-Brom-1-(2,4,6-trimethoxy-phenyl)-aethanon |
| NTMPB |