Benzenamine, N-[4-(4-chlorophenoxy)-2-butyn-1-yl]-N-methyl- structure
|
Common Name | Benzenamine, N-[4-(4-chlorophenoxy)-2-butyn-1-yl]-N-methyl- | ||
|---|---|---|---|---|
| CAS Number | 54109-59-0 | Molecular Weight | 285.76800 | |
| Density | 1.187g/cm3 | Boiling Point | 433ºC at 760mmHg | |
| Molecular Formula | C17H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.7ºC | |
| Name | N-[4-(4-chlorophenoxy)but-2-ynyl]-N-methylaniline |
|---|
| Density | 1.187g/cm3 |
|---|---|
| Boiling Point | 433ºC at 760mmHg |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.76800 |
| Flash Point | 215.7ºC |
| Exact Mass | 285.09200 |
| PSA | 12.47000 |
| LogP | 3.85860 |
| Index of Refraction | 1.611 |
| InChIKey | UZWHWGYRQCZSLC-UHFFFAOYSA-N |
| SMILES | CN(CC#CCOc1ccc(Cl)cc1)c1ccccc1 |
|
~%
Benzenamine, N-... CAS#:54109-59-0 |
| Literature: Hillard,J. et al. Journal of Heterocyclic Chemistry, 1974 , vol. 11, p. 369 - 375 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |