3-bromo-3-(3-nitrophenyl)propanoic acid structure
|
Common Name | 3-bromo-3-(3-nitrophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5411-60-9 | Molecular Weight | 274.06800 | |
| Density | 1.722g/cm3 | Boiling Point | 375.9ºC at 760 mmHg | |
| Molecular Formula | C9H8BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.1ºC | |
| Name | 3-bromo-3-(3-nitrophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.722g/cm3 |
|---|---|
| Boiling Point | 375.9ºC at 760 mmHg |
| Molecular Formula | C9H8BrNO4 |
| Molecular Weight | 274.06800 |
| Flash Point | 181.1ºC |
| Exact Mass | 272.96400 |
| PSA | 83.12000 |
| LogP | 3.02870 |
| Index of Refraction | 1.625 |
| InChIKey | DEKRYHWYJDKPOF-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(Br)c1cccc([N+](=O)[O-])c1 |
| HS Code | 2916399090 |
|---|
|
~%
3-bromo-3-(3-ni... CAS#:5411-60-9 |
| Literature: Prausnitz Chemische Berichte, 1884 , vol. 17, p. 597 |
|
~%
3-bromo-3-(3-ni... CAS#:5411-60-9 |
| Literature: Prausnitz Chemische Berichte, 1884 , vol. 17, p. 597 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Brom-3-(3-nitro-phenyl)-propionsaeure |
| 3-bromo-3-(3-nitro-phenyl)-propionic acid |