2,6-Dibromo-1,7-diphenyl-1,7-heptanedione
2,6-Dibromo-1,7-diphenyl-1,7-heptanedione structure
|
Common Name | 2,6-Dibromo-1,7-diphenyl-1,7-heptanedione | ||
|---|---|---|---|---|
| CAS Number | 5411-99-4 | Molecular Weight | 438.15300 | |
| Density | 1.51g/cm3 | Boiling Point | 532.1ºC at 760 mmHg | |
| Molecular Formula | C19H18Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.8ºC | |
Summary: 2,6-Dibromo-1,7-diphenyl-1,7-heptanedione (Chinese name: 2,6-二溴-1,7-二苯庚烷-1,7-二酮, CAS number: 5411-99-4, molecular formula: C19H18Br2O2, molecular weight: 438.15300), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-dibromo-1,7-diphenylheptane-1,7-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 532.1ºC at 760 mmHg |
| Molecular Formula | C19H18Br2O2 |
| Molecular Weight | 438.15300 |
| Flash Point | 121.8ºC |
| Exact Mass | 435.96700 |
| PSA | 34.14000 |
| LogP | 5.44950 |
| Index of Refraction | 1.604 |
| InChIKey | GOIXPFUGOIGQHG-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(Br)CCCC(Br)C(=O)c1ccccc1 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| WLN: RVYE3YEVR |
| 1,5-Dibromo-1,5-dibenzoylpentane |
| 2,6-Dibromo-1,7-diphenyl-1,7-heptanedione |
| 1,7-HEPTANEDIONE,2,6-DIBROMO-1,7-DIPHENYL |
| 1,2,6-dibromo-1,7-diphenyl |
| 1,5-Dibenzoyl-1,5-dibromopentane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2,6-dibromo-1,7-diphenylheptane-1,7-dione have? |
| A: English synonyms of 2,6-dibromo-1,7-diphenylheptane-1,7-dione: WLN: RVYE3YEVR, 1,5-Dibromo-1,5-dibenzoylpentane, 2,6-Dibromo-1,7-diphenyl-1,7-heptanedione, 1,7-HEPTANEDIONE,2,6-DIBROMO-1,7-DIPHENYL, 1,2,6-dibromo-1,7-diphenyl, 1,5-Dibenzoyl-1,5-dibromopentane. |
| Q: What are the upstream materials of 2,6-dibromo-1,7-diphenylheptane-1,7-dione? |
| A: Related upstream materials(CAS) of 2,6-dibromo-1,7-diphenylheptane-1,7-dione: 28861-22-5. |
| Q: What is the SMILES notation of 2,6-dibromo-1,7-diphenylheptane-1,7-dione? |
| A: SMILES notation of 2,6-dibromo-1,7-diphenylheptane-1,7-dione is O=C(c1ccccc1)C(Br)CCCC(Br)C(=O)c1ccccc1. |
| Q: What is the CAS number of 2,6-dibromo-1,7-diphenylheptane-1,7-dione? |
| A: CAS number of 2,6-dibromo-1,7-diphenylheptane-1,7-dione is 5411-99-4. |
| Q: What is the molecular weight of 2,6-dibromo-1,7-diphenylheptane-1,7-dione? |
| A: Molecular weight of 2,6-dibromo-1,7-diphenylheptane-1,7-dione is 438.15300. |
| Q: What is the polar surface area (PSA) of 2,6-dibromo-1,7-diphenylheptane-1,7-dione? |
| A: Polar surface area (PSA) of 2,6-dibromo-1,7-diphenylheptane-1,7-dione is 34.14000. |
| Q: What is the boiling point of 2,6-dibromo-1,7-diphenylheptane-1,7-dione? |
| A: Boiling point of 2,6-dibromo-1,7-diphenylheptane-1,7-dione is 532.1ºC at 760 mmHg. |
| Q: What is the LogP of 2,6-dibromo-1,7-diphenylheptane-1,7-dione? |
| A: LogP of 2,6-dibromo-1,7-diphenylheptane-1,7-dione is 5.44950. |
| Q: What is the English name of 2,6-dibromo-1,7-diphenylheptane-1,7-dione? |
| A: The English name of 2,6-dibromo-1,7-diphenylheptane-1,7-dione is 2,6-dibromo-1,7-diphenylheptane-1,7-dione. |
| Q: What is the InChIKey of 2,6-dibromo-1,7-diphenylheptane-1,7-dione? |
| A: InChIKey of 2,6-dibromo-1,7-diphenylheptane-1,7-dione is GOIXPFUGOIGQHG-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |