ethyl 2-dimethylamino-4-oxo-3H-pyrimidine-5-carboxylate structure
|
Common Name | ethyl 2-dimethylamino-4-oxo-3H-pyrimidine-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 54127-88-7 | Molecular Weight | 211.21800 | |
| Density | 1.25g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(dimethylamino)-6-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.21800 |
| Exact Mass | 211.09600 |
| PSA | 75.29000 |
| LogP | 0.01260 |
| Index of Refraction | 1.558 |
| InChIKey | QCIFTCNILVVFLO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc(N(C)C)[nH]c1=O |
| HS Code | 2933599090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-dimethylamino-6-oxo-1,6-dihydro-pyrimidine-5-carboxylic acid ethyl ester |
| ETHYL 2-DIMETHYLAMINO-4-OXO-3H-PYRIMIDINE-5-CARBOXYLATE |
| ethyl 2-(dimethylamino)-6-oxo-1,6-dihydropyrimidine-5-carboxylate |