diethyl 2-(5-acetyloxypentyl)-2-methylpropanedioate structure
|
Common Name | diethyl 2-(5-acetyloxypentyl)-2-methylpropanedioate | ||
|---|---|---|---|---|
| CAS Number | 54131-72-5 | Molecular Weight | 302.36300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-(5-acetyloxypentyl)-2-methylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H26O6 |
|---|---|
| Molecular Weight | 302.36300 |
| Exact Mass | 302.17300 |
| PSA | 78.90000 |
| LogP | 2.24240 |
| InChIKey | MLXQOFPEBIXBNI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(CCCCCOC(C)=O)C(=O)OCC |
|
~50%
diethyl 2-(5-ac... CAS#:54131-72-5 |
| Literature: Merck and Co., Inc. Patent: US4055597 A1, 1977 ; |
|
~51%
diethyl 2-(5-ac... CAS#:54131-72-5 |
| Literature: Merck and Co., Inc. Patent: US4066692 A1, 1978 ; |
| diethyl (5-acetoxypentyl) methylmalonate |
| Diethyl-(5-acetoxypentyl)-methylmalonat |
| Propanedioic acid,[5-(acetyloxy)pentyl]methyl-,diethyl ester |