1H-Pyrazolo[3,4-d]pyrimidine, 4-anilino-6-chloro-1-phenyl- structure
|
Common Name | 1H-Pyrazolo[3,4-d]pyrimidine, 4-anilino-6-chloro-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5414-01-7 | Molecular Weight | 321.76400 | |
| Density | 1.39g/cm3 | Boiling Point | 464.3ºC at 760 mmHg | |
| Molecular Formula | C17H12ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.6ºC | |
| Name | 1H-Pyrazolo[3,4-d]pyrimidine, 4-anilino-6-chloro-1-phenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 464.3ºC at 760 mmHg |
| Molecular Formula | C17H12ClN5 |
| Molecular Weight | 321.76400 |
| Flash Point | 234.6ºC |
| Exact Mass | 321.07800 |
| PSA | 55.63000 |
| LogP | 4.28550 |
| Index of Refraction | 1.721 |
| InChIKey | KPVPTINGBNRXOZ-UHFFFAOYSA-N |
| SMILES | Clc1nc(Nc2ccccc2)c2cnn(-c3ccccc3)c2n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (6-chloro-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)-hydrazine |
| (6-Chlor-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)-phenyl-amin |
| (6-Chlor-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)-hydrazin |
| 6-chloro-4-hydrazinyl-1-phenyl-1h-pyrazolo[3,4-d]pyrimidine |
| (6-chloro-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)-phenyl-amine |