3-chloro-9-phenyl-N-tert-butyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,5,7-tetraen-5-amine structure
|
Common Name | 3-chloro-9-phenyl-N-tert-butyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,5,7-tetraen-5-amine | ||
|---|---|---|---|---|
| CAS Number | 5414-05-1 | Molecular Weight | 301.77400 | |
| Density | 1.31g/cm3 | Boiling Point | 405.6ºC at 760 mmHg | |
| Molecular Formula | C15H16ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.1ºC | |
| Name | N-tert-butyl-6-chloro-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 405.6ºC at 760 mmHg |
| Molecular Formula | C15H16ClN5 |
| Molecular Weight | 301.77400 |
| Flash Point | 199.1ºC |
| Exact Mass | 301.10900 |
| PSA | 55.63000 |
| LogP | 3.75230 |
| Index of Refraction | 1.657 |
| InChIKey | YXPGNIHEYNVAAI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Nc1nc(Cl)nc2c1cnn2-c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |