Ethanol, 2-[ (5-tert-butylsalicyl)amino]- structure
|
Common Name | Ethanol, 2-[ (5-tert-butylsalicyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 5414-71-1 | Molecular Weight | 223.31100 | |
| Density | 1.062g/cm3 | Boiling Point | 374ºC at 760 mmHg | |
| Molecular Formula | C13H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.8ºC | |
| Name | 4-tert-butyl-2-[(2-hydroxyethylamino)methyl]phenol |
|---|
| Density | 1.062g/cm3 |
|---|---|
| Boiling Point | 374ºC at 760 mmHg |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.31100 |
| Flash Point | 124.8ºC |
| Exact Mass | 223.15700 |
| PSA | 52.49000 |
| LogP | 2.16250 |
| Index of Refraction | 1.538 |
| InChIKey | VZRUUURGBKLZGH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(O)c(CNCCO)c1 |
| HS Code | 2922509090 |
|---|
|
~%
Ethanol, 2-[ (5... CAS#:5414-71-1 |
| Literature: Bruson Journal of the American Chemical Society, 1936 , vol. 58, p. 1741,1744 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |