Phenol,2,6-bis[(dimethylamino)methyl]-4-(1,1-dimethylethyl)- structure
|
Common Name | Phenol,2,6-bis[(dimethylamino)methyl]-4-(1,1-dimethylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 5414-79-9 | Molecular Weight | 264.40600 | |
| Density | 0.987g/cm3 | Boiling Point | 318.2ºC at 760 mmHg | |
| Molecular Formula | C16H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.8ºC | |
| Name | 4-tert-butyl-2,6-bis[(dimethylamino)methyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.987g/cm3 |
|---|---|
| Boiling Point | 318.2ºC at 760 mmHg |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.40600 |
| Flash Point | 106.8ºC |
| Exact Mass | 264.22000 |
| PSA | 26.71000 |
| LogP | 2.81290 |
| Index of Refraction | 1.527 |
| InChIKey | HFYDSFHQXIJOCT-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1cc(C(C)(C)C)cc(CN(C)C)c1O |
| HS Code | 2922299090 |
|---|
|
~81%
Phenol,2,6-bis[... CAS#:5414-79-9 |
| Literature: Tyman, John H.P.; Patel, Mahesh Journal of Chemical Research, 2007 , # 1 p. 34 - 37 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,6-Bis-<dimethylaminomethyl>-4-tert.-butyl-phenol |
| 4-tert-butyl-2,6-bis((dimethylamino)methyl)phenol |
| 2,6-bis-(N,N-dimethylaminomethyl)-4-t-butylphenol |