Benzenesulfonamide,4-amino-N-[2,6-dibromo-4-(1,1-dimethylpropyl)phenyl]- structure
|
Common Name | Benzenesulfonamide,4-amino-N-[2,6-dibromo-4-(1,1-dimethylpropyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 5414-81-3 | Molecular Weight | 476.22600 | |
| Density | 1.606g/cm3 | Boiling Point | 515.3ºC at 760mmHg | |
| Molecular Formula | C17H20Br2N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.4ºC | |
| Name | 4-amino-N-[2,6-dibromo-4-(2-methylbutan-2-yl)phenyl]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.606g/cm3 |
|---|---|
| Boiling Point | 515.3ºC at 760mmHg |
| Molecular Formula | C17H20Br2N2O2S |
| Molecular Weight | 476.22600 |
| Flash Point | 265.4ºC |
| Exact Mass | 473.96100 |
| PSA | 80.57000 |
| LogP | 7.01720 |
| Index of Refraction | 1.635 |
| InChIKey | RGRHLWHQACQZDY-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1cc(Br)c(NS(=O)(=O)c2ccc(N)cc2)c(Br)c1 |
| HS Code | 2935009090 |
|---|
|
~%
Benzenesulfonam... CAS#:5414-81-3 |
| Literature: Drake et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1602,1603 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Sulfanilsaeure-(2,6-dibrom-4-tert-pentyl-anilid) |
| Sulfanilsaeure-(2,6-dibrom-4-tert-butyl-anilid) |
| sulfanilic acid-(2,6-dibromo-4-tert-pentyl-anilide) |
| sulfanilic acid-(2,4-dinitro-anilide) |
| Benzenesulfonamide,4-amino-N-(2,4-dinitrophenyl) |
| Sulfanilsaeure-(2,4-dinitro-anilid) |
| sulfanilic acid-(2,6-dibromo-4-tert-butyl-anilide) |